C21H23F2NO3 — CID 24657081
(4-tert-butyl-2-methylphenyl) 3-[(2,4-difluorobenzoyl)amino]propanoate (PubChem CID 24657081) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 3-[(2,4-difluorobenzoyl)amino]propanoate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 3-[(2,4-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 24657081 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 3-[(2,4-difluorobenzoyl)amino]propanoate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H23F2NO3/c1-13-11-14(21(2,3)4)5-8-18(13)27-19(25)9-10-24-20(26)16-7-6-15(22)12-17(16)23/h5-8,11-12H,9-10H2,1-4H3,(H,24,26) |
| InChIKey | ZKRLXVFDSADHII-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|