C17H22N2O3 — CID 30823960
3-cyanopropyl 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 30823960) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-cyanopropyl 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | 3-cyanopropyl 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 30823960 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-cyanopropyl 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)OCCCC#N)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-17(2,3)14-8-6-13(7-9-14)16(21)19-12-15(20)22-11-5-4-10-18/h6-9H,4-5,11-12H2,1-3H3,(H,19,21) |
| InChIKey | FAFFRJOWEAMJPG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|