C22H27NO4 — CID 55568498
3-phenoxypropyl 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 55568498) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-phenoxypropyl 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | 3-phenoxypropyl 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55568498 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3-phenoxypropyl 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)OCCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-22(2,3)18-12-10-17(11-13-18)21(25)23-16-20(24)27-15-7-14-26-19-8-5-4-6-9-19/h4-6,8-13H,7,14-16H2,1-3H3,(H,23,25) |
| InChIKey | QCTFEVNPXWBXGM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|