About (2-hydroxy-2-methylpropyl) 2-benzamidoacetate
(2-hydroxy-2-methylpropyl) 2-benzamidoacetate (PubChem CID 134970204) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2-hydroxy-2-methylpropyl) 2-benzamidoacetate.
Molecular Properties
| Compound Name | (2-hydroxy-2-methylpropyl) 2-benzamidoacetate |
| PubChem CID | 134970204 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2-hydroxy-2-methylpropyl) 2-benzamidoacetate |
| SMILES | CC(C)(O)COC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-13(2,17)9-18-11(15)8-14-12(16)10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3,(H,14,16) |
| InChIKey | HDFADVOAUOFDOQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-hydroxy-2-methylpropyl) 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-2-methylpropyl) 2-benzamidoacetate?
The IUPAC name of (2-hydroxy-2-methylpropyl) 2-benzamidoacetate (CID 134970204) is (2-hydroxy-2-methylpropyl) 2-benzamidoacetate.
What is the SMILES notation for (2-hydroxy-2-methylpropyl) 2-benzamidoacetate?
The canonical SMILES for (2-hydroxy-2-methylpropyl) 2-benzamidoacetate is CC(C)(O)COC(=O)CNC(=O)c1ccccc1.
What is the InChIKey of (2-hydroxy-2-methylpropyl) 2-benzamidoacetate?
The InChIKey is HDFADVOAUOFDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-13(2,17)9-18-11(15)8-14-12(16)10-6-4-3-5-7-10/h3-7,17H,8-9H2,1-2H3,(H,14,16).
What are the key properties of (2-hydroxy-2-methylpropyl) 2-benzamidoacetate?
(2-hydroxy-2-methylpropyl) 2-benzamidoacetate has a molecular weight of 251.28 g/mol, XLogP of 0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-2-methylpropyl) 2-benzamidoacetate is sourced from PubChem (CID 134970204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).