About (carbamothioylamino) 2-benzamidoacetate
(carbamothioylamino) 2-benzamidoacetate (PubChem CID 174948338) has the molecular formula C10H11N3O3S
and a molecular weight of 253.28 g/mol. Its IUPAC name is (carbamothioylamino) 2-benzamidoacetate.
Molecular Properties
| Compound Name | (carbamothioylamino) 2-benzamidoacetate |
| PubChem CID | 174948338 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (carbamothioylamino) 2-benzamidoacetate |
| SMILES | NC(=S)NOC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H11N3O3S/c11-10(17)13-16-8(14)6-12-9(15)7-4-2-1-3-5-7/h1-5H,6H2,(H,12,15)(H3,11,13,17) |
| InChIKey | LUJUVYKHSAFYCM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (carbamothioylamino) 2-benzamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamothioylamino) 2-benzamidoacetate?
The IUPAC name of (carbamothioylamino) 2-benzamidoacetate (CID 174948338) is (carbamothioylamino) 2-benzamidoacetate.
What is the SMILES notation for (carbamothioylamino) 2-benzamidoacetate?
The canonical SMILES for (carbamothioylamino) 2-benzamidoacetate is NC(=S)NOC(=O)CNC(=O)c1ccccc1.
What is the InChIKey of (carbamothioylamino) 2-benzamidoacetate?
The InChIKey is LUJUVYKHSAFYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3S/c11-10(17)13-16-8(14)6-12-9(15)7-4-2-1-3-5-7/h1-5H,6H2,(H,12,15)(H3,11,13,17).
What are the key properties of (carbamothioylamino) 2-benzamidoacetate?
(carbamothioylamino) 2-benzamidoacetate has a molecular weight of 253.28 g/mol, XLogP of -0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamothioylamino) 2-benzamidoacetate is sourced from PubChem (CID 174948338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).