About (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate
(2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate (PubChem CID 141198806) has the molecular formula C17H15NO6
and a molecular weight of 329.31 g/mol. Its IUPAC name is (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate.
Molecular Properties
| Compound Name | (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate |
| PubChem CID | 141198806 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate |
| SMILES | O=C(CNC(=O)c1ccccc1)OOC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO6/c19-14(11-18-16(21)13-9-5-2-6-10-13)23-24-17(22)15(20)12-7-3-1-4-8-12/h1-10,15,20H,11H2,(H,18,21) |
| InChIKey | YHMGIDBPPDAHTJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate?
The IUPAC name of (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate (CID 141198806) is (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate.
What is the SMILES notation for (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate?
The canonical SMILES for (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate is O=C(CNC(=O)c1ccccc1)OOC(=O)C(O)c1ccccc1.
What is the InChIKey of (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate?
The InChIKey is YHMGIDBPPDAHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO6/c19-14(11-18-16(21)13-9-5-2-6-10-13)23-24-17(22)15(20)12-7-3-1-4-8-12/h1-10,15,20H,11H2,(H,18,21).
What are the key properties of (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate?
(2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate has a molecular weight of 329.31 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamidoacetyl) 2-hydroxy-2-phenylethaneperoxoate is sourced from PubChem (CID 141198806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).