C25H21NO7 — CID 57178092
4-(2-benzamidoacetyl)oxy-3-(4-hydroxyphenyl)-4-oxo-2-phenylbutanoic acid (PubChem CID 57178092) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-(2-benzamidoacetyl)oxy-3-(4-hydroxyphenyl)-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-(2-benzamidoacetyl)oxy-3-(4-hydroxyphenyl)-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 57178092 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-(2-benzamidoacetyl)oxy-3-(4-hydroxyphenyl)-4-oxo-2-phenylbutanoic acid |
| SMILES | O=C(CNC(=O)c1ccccc1)OC(=O)C(c1ccc(O)cc1)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H21NO7/c27-19-13-11-17(12-14-19)22(21(24(30)31)16-7-3-1-4-8-16)25(32)33-20(28)15-26-23(29)18-9-5-2-6-10-18/h1-14,21-22,27H,15H2,(H,26,29)(H,30,31) |
| InChIKey | NTUKCAVXIMWFMB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|