About benzamidothiourea
benzamidothiourea (PubChem CID 781748) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is benzamidothiourea.
Molecular Properties
| Compound Name | benzamidothiourea |
| PubChem CID | 781748 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | benzamidothiourea |
| SMILES | NC(=S)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H9N3OS/c9-8(13)11-10-7(12)6-4-2-1-3-5-6/h1-5H,(H,10,12)(H3,9,11,13) |
| InChIKey | OWKWAVBMKKZMHE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzamidothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamidothiourea?
The IUPAC name of benzamidothiourea (CID 781748) is benzamidothiourea.
What is the SMILES notation for benzamidothiourea?
The canonical SMILES for benzamidothiourea is NC(=S)NNC(=O)c1ccccc1.
What is the InChIKey of benzamidothiourea?
The InChIKey is OWKWAVBMKKZMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c9-8(13)11-10-7(12)6-4-2-1-3-5-6/h1-5H,(H,10,12)(H3,9,11,13).
What are the key properties of benzamidothiourea?
benzamidothiourea has a molecular weight of 195.25 g/mol, XLogP of 0.16, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamidothiourea is sourced from PubChem (CID 781748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).