About N'-oxidobenzohydrazide
N'-oxidobenzohydrazide (PubChem CID 174971627) has the molecular formula C7H7N2O2-
and a molecular weight of 151.14 g/mol. Its IUPAC name is N'-oxidobenzohydrazide.
Molecular Properties
| Compound Name | N'-oxidobenzohydrazide |
| PubChem CID | 174971627 |
| Molecular Formula | C7H7N2O2- |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | N'-oxidobenzohydrazide |
| SMILES | O=C(NN[O-])c1ccccc1 |
| InChI | InChI=1S/C7H7N2O2/c10-7(8-9-11)6-4-2-1-3-5-6/h1-5,9H,(H,8,10)/q-1 |
| InChIKey | ZKBNBBJDKRJUHF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-oxidobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-oxidobenzohydrazide?
The IUPAC name of N'-oxidobenzohydrazide (CID 174971627) is N'-oxidobenzohydrazide.
What is the SMILES notation for N'-oxidobenzohydrazide?
The canonical SMILES for N'-oxidobenzohydrazide is O=C(NN[O-])c1ccccc1.
What is the InChIKey of N'-oxidobenzohydrazide?
The InChIKey is ZKBNBBJDKRJUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O2/c10-7(8-9-11)6-4-2-1-3-5-6/h1-5,9H,(H,8,10)/q-1.
What are the key properties of N'-oxidobenzohydrazide?
N'-oxidobenzohydrazide has a molecular weight of 151.14 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-oxidobenzohydrazide is sourced from PubChem (CID 174971627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).