About lead(2+);bis(N-oxidobenzamide)
lead(2+);bis(N-oxidobenzamide) (PubChem CID 174994108) has the molecular formula C14H12N2O4Pb
and a molecular weight of 479.46 g/mol. Its IUPAC name is lead(2+);bis(N-oxidobenzamide).
Molecular Properties
| Compound Name | lead(2+);bis(N-oxidobenzamide) |
| PubChem CID | 174994108 |
| Molecular Formula | C14H12N2O4Pb |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | lead(2+);bis(N-oxidobenzamide) |
| SMILES | O=C(N[O-])c1ccccc1.O=C(N[O-])c1ccccc1.[Pb+2] |
| InChI | InChI=1S/2C7H6NO2.Pb/c2*9-7(8-10)6-4-2-1-3-5-6;/h2*1-5H,(H-,8,9,10);/q2*-1;+2 |
| InChIKey | NRWOILNCAPFVIC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);bis(N-oxidobenzamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);bis(N-oxidobenzamide)?
The IUPAC name of lead(2+);bis(N-oxidobenzamide) (CID 174994108) is lead(2+);bis(N-oxidobenzamide).
What is the SMILES notation for lead(2+);bis(N-oxidobenzamide)?
The canonical SMILES for lead(2+);bis(N-oxidobenzamide) is O=C(N[O-])c1ccccc1.O=C(N[O-])c1ccccc1.[Pb+2].
What is the InChIKey of lead(2+);bis(N-oxidobenzamide)?
The InChIKey is NRWOILNCAPFVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6NO2.Pb/c2*9-7(8-10)6-4-2-1-3-5-6;/h2*1-5H,(H-,8,9,10);/q2*-1;+2.
What are the key properties of lead(2+);bis(N-oxidobenzamide)?
lead(2+);bis(N-oxidobenzamide) has a molecular weight of 479.46 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);bis(N-oxidobenzamide) is sourced from PubChem (CID 174994108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).