About benzohydrazide;molybdenum
benzohydrazide;molybdenum (PubChem CID 162076561) has the molecular formula C7H8MoN2O
and a molecular weight of 232.09 g/mol. Its IUPAC name is benzohydrazide;molybdenum.
Molecular Properties
| Compound Name | benzohydrazide;molybdenum |
| PubChem CID | 162076561 |
| Molecular Formula | C7H8MoN2O |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | benzohydrazide;molybdenum |
| SMILES | NNC(=O)c1ccccc1.[Mo] |
| InChI | InChI=1S/C7H8N2O.Mo/c8-9-7(10)6-4-2-1-3-5-6;/h1-5H,8H2,(H,9,10); |
| InChIKey | ZBTYDBPMKIOHMB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzohydrazide;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzohydrazide;molybdenum?
The IUPAC name of benzohydrazide;molybdenum (CID 162076561) is benzohydrazide;molybdenum.
What is the SMILES notation for benzohydrazide;molybdenum?
The canonical SMILES for benzohydrazide;molybdenum is NNC(=O)c1ccccc1.[Mo].
What is the InChIKey of benzohydrazide;molybdenum?
The InChIKey is ZBTYDBPMKIOHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.Mo/c8-9-7(10)6-4-2-1-3-5-6;/h1-5H,8H2,(H,9,10);.
What are the key properties of benzohydrazide;molybdenum?
benzohydrazide;molybdenum has a molecular weight of 232.09 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzohydrazide;molybdenum is sourced from PubChem (CID 162076561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).