C16H16N2O — CID 1386818
4-[(1R,2R)-2-phenylcyclopropyl]benzohydrazide (PubChem CID 1386818) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 4-[(1R,2R)-2-phenylcyclopropyl]benzohydrazide.
| Compound Name | 4-[(1R,2R)-2-phenylcyclopropyl]benzohydrazide |
|---|---|
| PubChem CID | 1386818 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 4-[(1R,2R)-2-phenylcyclopropyl]benzohydrazide |
| SMILES | NNC(=O)c1ccc([C@@H]2C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O/c17-18-16(19)13-8-6-12(7-9-13)15-10-14(15)11-4-2-1-3-5-11/h1-9,14-15H,10,17H2,(H,18,19)/t14-,15-/m0/s1 |
| InChIKey | NCCXTIMHSSGUEJ-GJZGRUSLSA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|