C10H6N4O4-2 — CID 14288195
2-N,3-N-dioxidoquinoxaline-2,3-dicarboxamide (PubChem CID 14288195) has the molecular formula C10H6N4O4-2 and a molecular weight of 246.18 g/mol. Its IUPAC name is 2-N,3-N-dioxidoquinoxaline-2,3-dicarboxamide.
| Compound Name | 2-N,3-N-dioxidoquinoxaline-2,3-dicarboxamide |
|---|---|
| PubChem CID | 14288195 |
| Molecular Formula | C10H6N4O4-2 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2-N,3-N-dioxidoquinoxaline-2,3-dicarboxamide |
| SMILES | O=C(N[O-])c1nc2ccccc2nc1C(=O)N[O-] |
| InChI | InChI=1S/C10H6N4O4/c15-9(13-17)7-8(10(16)14-18)12-6-4-2-1-3-5(6)11-7/h1-4H,(H2-2,11,12,13,14,15,16,17,18)/q-2 |
| InChIKey | VIBUBPDURZFNHH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|