About phenazine;silver
phenazine;silver (PubChem CID 175026023) has the molecular formula C12H8AgN2
and a molecular weight of 288.08 g/mol. Its IUPAC name is phenazine;silver.
Molecular Properties
| Compound Name | phenazine;silver |
| PubChem CID | 175026023 |
| Molecular Formula | C12H8AgN2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | phenazine;silver |
| SMILES | [Ag].c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.Ag/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;/h1-8H; |
| InChIKey | UJRHOHXUNDVGTE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine;silver?
The IUPAC name of phenazine;silver (CID 175026023) is phenazine;silver.
What is the SMILES notation for phenazine;silver?
The canonical SMILES for phenazine;silver is [Ag].c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of phenazine;silver?
The InChIKey is UJRHOHXUNDVGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.Ag/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;/h1-8H;.
What are the key properties of phenazine;silver?
phenazine;silver has a molecular weight of 288.08 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine;silver is sourced from PubChem (CID 175026023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).