C18H8F5IN2 — CID 139175725
1,2,3,4,5-pentafluoro-6-iodobenzene;phenazine (PubChem CID 139175725) has the molecular formula C18H8F5IN2 and a molecular weight of 474.17 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-iodobenzene;phenazine.
| Compound Name | 1,2,3,4,5-pentafluoro-6-iodobenzene;phenazine |
|---|---|
| PubChem CID | 139175725 |
| Molecular Formula | C18H8F5IN2 |
| Molecular Weight | 474.17 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-iodobenzene;phenazine |
| SMILES | Fc1c(F)c(F)c(I)c(F)c1F.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2.C6F5I/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10;7-1-2(8)4(10)6(12)5(11)3(1)9/h1-8H; |
| InChIKey | GOWOGTWKOTWQCM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|