C26H14F4I2N6 — CID 139202934
1,2,4,5-tetrafluoro-3,6-diiodobenzene;bis(triazolo[1,5-a]quinoline) (PubChem CID 139202934) has the molecular formula C26H14F4I2N6 and a molecular weight of 740.24 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-diiodobenzene;bis(triazolo[1,5-a]quinoline).
| Compound Name | 1,2,4,5-tetrafluoro-3,6-diiodobenzene;bis(triazolo[1,5-a]quinoline) |
|---|---|
| PubChem CID | 139202934 |
| Molecular Formula | C26H14F4I2N6 |
| Molecular Weight | 740.24 g/mol |
| Exact Mass | 739.93 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-diiodobenzene;bis(triazolo[1,5-a]quinoline) |
| SMILES | Fc1c(F)c(I)c(F)c(F)c1I.c1ccc2c(c1)ccc1cnnn12.c1ccc2c(c1)ccc1cnnn12 |
| InChI | InChI=1S/2C10H7N3.C6F4I2/c2*1-2-4-10-8(3-1)5-6-9-7-11-12-13(9)10;7-1-2(8)6(12)4(10)3(9)5(1)11/h2*1-7H; |
| InChIKey | AVQJINSZEYICAJ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.24 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|