About imidazo[1,5-a]quinolin-1-yl thiocyanate
imidazo[1,5-a]quinolin-1-yl thiocyanate (PubChem CID 175713096) has the molecular formula C12H7N3S
and a molecular weight of 225.28 g/mol. Its IUPAC name is imidazo[1,5-a]quinolin-1-yl thiocyanate.
Molecular Properties
| Compound Name | imidazo[1,5-a]quinolin-1-yl thiocyanate |
| PubChem CID | 175713096 |
| Molecular Formula | C12H7N3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | imidazo[1,5-a]quinolin-1-yl thiocyanate |
| SMILES | N#CSc1ncc2ccc3ccccc3n12 |
| InChI | InChI=1S/C12H7N3S/c13-8-16-12-14-7-10-6-5-9-3-1-2-4-11(9)15(10)12/h1-7H |
| InChIKey | GMXPLOVHGJIYDR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,5-a]quinolin-1-yl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,5-a]quinolin-1-yl thiocyanate?
The IUPAC name of imidazo[1,5-a]quinolin-1-yl thiocyanate (CID 175713096) is imidazo[1,5-a]quinolin-1-yl thiocyanate.
What is the SMILES notation for imidazo[1,5-a]quinolin-1-yl thiocyanate?
The canonical SMILES for imidazo[1,5-a]quinolin-1-yl thiocyanate is N#CSc1ncc2ccc3ccccc3n12.
What is the InChIKey of imidazo[1,5-a]quinolin-1-yl thiocyanate?
The InChIKey is GMXPLOVHGJIYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3S/c13-8-16-12-14-7-10-6-5-9-3-1-2-4-11(9)15(10)12/h1-7H.
What are the key properties of imidazo[1,5-a]quinolin-1-yl thiocyanate?
imidazo[1,5-a]quinolin-1-yl thiocyanate has a molecular weight of 225.28 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,5-a]quinolin-1-yl thiocyanate is sourced from PubChem (CID 175713096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).