C13H8N2 — CID 90936676
pyrrolo[1,2-a]quinoline-3-carbonitrile (PubChem CID 90936676) has the molecular formula C13H8N2 and a molecular weight of 192.22 g/mol. Its IUPAC name is pyrrolo[1,2-a]quinoline-3-carbonitrile.
| Compound Name | pyrrolo[1,2-a]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90936676 |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | pyrrolo[1,2-a]quinoline-3-carbonitrile |
| SMILES | N#Cc1ccn2c1ccc1ccccc12 |
| InChI | InChI=1S/C13H8N2/c14-9-11-7-8-15-12-4-2-1-3-10(12)5-6-13(11)15/h1-8H |
| InChIKey | MWLLEUHLNYNGNY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |