About pyrido[1,2-a]indole-8-carbonitrile
pyrido[1,2-a]indole-8-carbonitrile (PubChem CID 91666081) has the molecular formula C13H8N2
and a molecular weight of 192.22 g/mol. Its IUPAC name is pyrido[1,2-a]indole-8-carbonitrile.
Molecular Properties
| Compound Name | pyrido[1,2-a]indole-8-carbonitrile |
| PubChem CID | 91666081 |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | pyrido[1,2-a]indole-8-carbonitrile |
| SMILES | N#Cc1ccn2c(c1)cc1ccccc12 |
| InChI | InChI=1S/C13H8N2/c14-9-10-5-6-15-12(7-10)8-11-3-1-2-4-13(11)15/h1-8H |
| InChIKey | AYOFJFQSQAUXTM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrido[1,2-a]indole-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[1,2-a]indole-8-carbonitrile?
The IUPAC name of pyrido[1,2-a]indole-8-carbonitrile (CID 91666081) is pyrido[1,2-a]indole-8-carbonitrile.
What is the SMILES notation for pyrido[1,2-a]indole-8-carbonitrile?
The canonical SMILES for pyrido[1,2-a]indole-8-carbonitrile is N#Cc1ccn2c(c1)cc1ccccc12.
What is the InChIKey of pyrido[1,2-a]indole-8-carbonitrile?
The InChIKey is AYOFJFQSQAUXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2/c14-9-10-5-6-15-12(7-10)8-11-3-1-2-4-13(11)15/h1-8H.
What are the key properties of pyrido[1,2-a]indole-8-carbonitrile?
pyrido[1,2-a]indole-8-carbonitrile has a molecular weight of 192.22 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[1,2-a]indole-8-carbonitrile is sourced from PubChem (CID 91666081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).