About pyrido[1,2-a]indol-8-ylmethanol
pyrido[1,2-a]indol-8-ylmethanol (PubChem CID 70366473) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is pyrido[1,2-a]indol-8-ylmethanol.
Molecular Properties
| Compound Name | pyrido[1,2-a]indol-8-ylmethanol |
| PubChem CID | 70366473 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | pyrido[1,2-a]indol-8-ylmethanol |
| SMILES | OCc1ccn2c(c1)cc1ccccc12 |
| InChI | InChI=1S/C13H11NO/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14/h1-8,15H,9H2 |
| InChIKey | MAZLUXDGZULQNH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrido[1,2-a]indol-8-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[1,2-a]indol-8-ylmethanol?
The IUPAC name of pyrido[1,2-a]indol-8-ylmethanol (CID 70366473) is pyrido[1,2-a]indol-8-ylmethanol.
What is the SMILES notation for pyrido[1,2-a]indol-8-ylmethanol?
The canonical SMILES for pyrido[1,2-a]indol-8-ylmethanol is OCc1ccn2c(c1)cc1ccccc12.
What is the InChIKey of pyrido[1,2-a]indol-8-ylmethanol?
The InChIKey is MAZLUXDGZULQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c15-9-10-5-6-14-12(7-10)8-11-3-1-2-4-13(11)14/h1-8,15H,9H2.
What are the key properties of pyrido[1,2-a]indol-8-ylmethanol?
pyrido[1,2-a]indol-8-ylmethanol has a molecular weight of 197.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[1,2-a]indol-8-ylmethanol is sourced from PubChem (CID 70366473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).