About 1H-indol-3-ylmethanol
1H-indol-3-ylmethanol (PubChem CID 3712) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1H-indol-3-ylmethanol.
Molecular Properties
| Compound Name | 1H-indol-3-ylmethanol |
| PubChem CID | 3712 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1H-indol-3-ylmethanol |
| SMILES | OCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H9NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,10-11H,6H2 |
| InChIKey | IVYPNXXAYMYVSP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indol-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-ylmethanol?
The IUPAC name of 1H-indol-3-ylmethanol (CID 3712) is 1H-indol-3-ylmethanol.
What is the SMILES notation for 1H-indol-3-ylmethanol?
The canonical SMILES for 1H-indol-3-ylmethanol is OCc1c[nH]c2ccccc12.
What is the InChIKey of 1H-indol-3-ylmethanol?
The InChIKey is IVYPNXXAYMYVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,10-11H,6H2.
What are the key properties of 1H-indol-3-ylmethanol?
1H-indol-3-ylmethanol has a molecular weight of 147.18 g/mol, XLogP of 1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-ylmethanol is sourced from PubChem (CID 3712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).