About Serotonin
Serotonin (PubChem CID 5202) has the molecular formula C10H12N2O
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol.
Molecular Properties
| Compound Name | Serotonin |
| PubChem CID | 5202 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| InChIKey | QZAYGJVTTNCVMB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 174 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Serotonin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Serotonin?
The IUPAC name of Serotonin (CID 5202) is 3-(2-aminoethyl)-1H-indol-5-ol.
What is the SMILES notation for Serotonin?
The canonical SMILES for Serotonin is C1=CC2=C(C=C1O)C(=CN2)CCN.
What is the InChIKey of Serotonin?
The InChIKey is QZAYGJVTTNCVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2.
What are the key properties of Serotonin?
Serotonin has a molecular weight of 176.21 g/mol, XLogP of 0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Serotonin is sourced from PubChem (CID 5202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).