About (+-)-5-Hydroxytryptophan
(+-)-5-Hydroxytryptophan (PubChem CID 144) has the molecular formula C11H12N2O3
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | (+-)-5-Hydroxytryptophan |
| PubChem CID | 144 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N |
| InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| InChIKey | LDCYZAJDBXYCGN-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 272 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (+-)-5-Hydroxytryptophan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (+-)-5-Hydroxytryptophan?
The IUPAC name of (+-)-5-Hydroxytryptophan (CID 144) is 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid.
What is the SMILES notation for (+-)-5-Hydroxytryptophan?
The canonical SMILES for (+-)-5-Hydroxytryptophan is C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N.
What is the InChIKey of (+-)-5-Hydroxytryptophan?
The InChIKey is LDCYZAJDBXYCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16).
What are the key properties of (+-)-5-Hydroxytryptophan?
(+-)-5-Hydroxytryptophan has a molecular weight of 220.22 g/mol, XLogP of -1.20, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (+-)-5-Hydroxytryptophan is sourced from PubChem (CID 144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).