About Indole-3-Acetic Acid
Indole-3-Acetic Acid (PubChem CID 802) has the molecular formula C10H9NO2
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)acetic acid.
Molecular Properties
| Compound Name | Indole-3-Acetic Acid |
| PubChem CID | 802 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-(1H-indol-3-yl)acetic acid |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)O |
| InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
| InChIKey | SEOVTRFCIGRIMH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 205 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Indole-3-Acetic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Indole-3-Acetic Acid?
The IUPAC name of Indole-3-Acetic Acid (CID 802) is 2-(1H-indol-3-yl)acetic acid.
What is the SMILES notation for Indole-3-Acetic Acid?
The canonical SMILES for Indole-3-Acetic Acid is C1=CC=C2C(=C1)C(=CN2)CC(=O)O.
What is the InChIKey of Indole-3-Acetic Acid?
The InChIKey is SEOVTRFCIGRIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13).
What are the key properties of Indole-3-Acetic Acid?
Indole-3-Acetic Acid has a molecular weight of 175.18 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Indole-3-Acetic Acid is sourced from PubChem (CID 802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).