C17H11N3 — CID 11161205
2-methyl-1-phenylindolizine-3,7-dicarbonitrile (PubChem CID 11161205) has the molecular formula C17H11N3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-methyl-1-phenylindolizine-3,7-dicarbonitrile.
| Compound Name | 2-methyl-1-phenylindolizine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 11161205 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-methyl-1-phenylindolizine-3,7-dicarbonitrile |
| SMILES | Cc1c(-c2ccccc2)c2cc(C#N)ccn2c1C#N |
| InChI | InChI=1S/C17H11N3/c1-12-16(11-19)20-8-7-13(10-18)9-15(20)17(12)14-5-3-2-4-6-14/h2-9H,1H3 |
| InChIKey | GOAHHSPWXKHGFU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |