C38H21N3 — CID 164529050
10-(3,5-diphenylphenyl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene-4,16-dicarbonitrile (PubChem CID 164529050) has the molecular formula C38H21N3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 10-(3,5-diphenylphenyl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene-4,16-dicarbonitrile.
| Compound Name | 10-(3,5-diphenylphenyl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene-4,16-dicarbonitrile |
|---|---|
| PubChem CID | 164529050 |
| Molecular Formula | C38H21N3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 10-(3,5-diphenylphenyl)-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene-4,16-dicarbonitrile |
| SMILES | N#Cc1ccc2c3cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc4c5ccc(C#N)cc5n(c2c1)c34 |
| InChI | InChI=1S/C38H21N3/c39-22-24-11-13-32-34-20-31(21-35-33-14-12-25(23-40)16-37(33)41(38(34)35)36(32)15-24)30-18-28(26-7-3-1-4-8-26)17-29(19-30)27-9-5-2-6-10-27/h1-21H |
| InChIKey | JHXJRQNTHXXJJN-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |