About (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate
(7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate (PubChem CID 57396388) has the molecular formula C28H17F3N2O3S
and a molecular weight of 518.52 g/mol. Its IUPAC name is (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 57396388 |
| Molecular Formula | C28H17F3N2O3S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate |
| SMILES | N#Cc1ccn2c(-c3ccccc3)c(-c3ccccc3)c(OS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2c1 |
| InChI | InChI=1S/C28H17F3N2O3S/c29-28(30,31)22-11-13-23(14-12-22)37(34,35)36-27-24-17-19(18-32)15-16-33(24)26(21-9-5-2-6-10-21)25(27)20-7-3-1-4-8-20/h1-17H |
| InChIKey | RUDGUXJLAUWPGP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate (CID 57396388) is (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate is N#Cc1ccn2c(-c3ccccc3)c(-c3ccccc3)c(OS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2c1.
What is the InChIKey of (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is RUDGUXJLAUWPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17F3N2O3S/c29-28(30,31)22-11-13-23(14-12-22)37(34,35)36-27-24-17-19(18-32)15-16-33(24)26(21-9-5-2-6-10-21)25(27)20-7-3-1-4-8-20/h1-17H.
What are the key properties of (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate?
(7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 518.52 g/mol, XLogP of 6.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-cyano-2,3-diphenylindolizin-1-yl) 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 57396388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).