C27H17F9O3S2 — CID 87484672
[phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 87484672) has the molecular formula C27H17F9O3S2 and a molecular weight of 624.55 g/mol. Its IUPAC name is [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87484672 |
| Molecular Formula | C27H17F9O3S2 |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.05 |
| IUPAC Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H17F9O3S2/c28-25(29,30)18-6-12-22(13-7-18)40(21-4-2-1-3-5-21,23-14-8-19(9-15-23)26(31,32)33)39-41(37,38)24-16-10-20(11-17-24)27(34,35)36/h1-17H |
| InChIKey | QRKURHOURWLGLR-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |