About (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate
(triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate (PubChem CID 87177204) has the molecular formula C28H22O3S2
and a molecular weight of 470.62 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate |
| PubChem CID | 87177204 |
| Molecular Formula | C28H22O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H22O3S2/c29-33(30,28-21-20-23-12-10-11-13-24(23)22-28)31-32(25-14-4-1-5-15-25,26-16-6-2-7-17-26)27-18-8-3-9-19-27/h1-22H |
| InChIKey | WNBBYMXSECFZAN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate?
The IUPAC name of (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate (CID 87177204) is (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate is O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate?
The InChIKey is WNBBYMXSECFZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22O3S2/c29-33(30,28-21-20-23-12-10-11-13-24(23)22-28)31-32(25-14-4-1-5-15-25,26-16-6-2-7-17-26)27-18-8-3-9-19-27/h1-22H.
What are the key properties of (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate?
(triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate has a molecular weight of 470.62 g/mol, XLogP of 7.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) naphthalene-2-sulfonate is sourced from PubChem (CID 87177204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).