About ethyl naphthalene-2-sulfonate;iron
ethyl naphthalene-2-sulfonate;iron (PubChem CID 87451141) has the molecular formula C12H12FeO3S
and a molecular weight of 292.14 g/mol. Its IUPAC name is ethyl naphthalene-2-sulfonate;iron.
Molecular Properties
| Compound Name | ethyl naphthalene-2-sulfonate;iron |
| PubChem CID | 87451141 |
| Molecular Formula | C12H12FeO3S |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | ethyl naphthalene-2-sulfonate;iron |
| SMILES | CCOS(=O)(=O)c1ccc2ccccc2c1.[Fe] |
| InChI | InChI=1S/C12H12O3S.Fe/c1-2-15-16(13,14)12-8-7-10-5-3-4-6-11(10)9-12;/h3-9H,2H2,1H3; |
| InChIKey | HMIVCRCZQKCJMR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl naphthalene-2-sulfonate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl naphthalene-2-sulfonate;iron?
The IUPAC name of ethyl naphthalene-2-sulfonate;iron (CID 87451141) is ethyl naphthalene-2-sulfonate;iron.
What is the SMILES notation for ethyl naphthalene-2-sulfonate;iron?
The canonical SMILES for ethyl naphthalene-2-sulfonate;iron is CCOS(=O)(=O)c1ccc2ccccc2c1.[Fe].
What is the InChIKey of ethyl naphthalene-2-sulfonate;iron?
The InChIKey is HMIVCRCZQKCJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3S.Fe/c1-2-15-16(13,14)12-8-7-10-5-3-4-6-11(10)9-12;/h3-9H,2H2,1H3;.
What are the key properties of ethyl naphthalene-2-sulfonate;iron?
ethyl naphthalene-2-sulfonate;iron has a molecular weight of 292.14 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl naphthalene-2-sulfonate;iron is sourced from PubChem (CID 87451141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).