About ethyl 3-ethylbenzenesulfonate
ethyl 3-ethylbenzenesulfonate (PubChem CID 22762316) has the molecular formula C10H14O3S
and a molecular weight of 214.29 g/mol. Its IUPAC name is ethyl 3-ethylbenzenesulfonate.
Molecular Properties
| Compound Name | ethyl 3-ethylbenzenesulfonate |
| PubChem CID | 22762316 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | ethyl 3-ethylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1cccc(CC)c1 |
| InChI | InChI=1S/C10H14O3S/c1-3-9-6-5-7-10(8-9)14(11,12)13-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | YHDVVQRWBHVCQR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethylbenzenesulfonate?
The IUPAC name of ethyl 3-ethylbenzenesulfonate (CID 22762316) is ethyl 3-ethylbenzenesulfonate.
What is the SMILES notation for ethyl 3-ethylbenzenesulfonate?
The canonical SMILES for ethyl 3-ethylbenzenesulfonate is CCOS(=O)(=O)c1cccc(CC)c1.
What is the InChIKey of ethyl 3-ethylbenzenesulfonate?
The InChIKey is YHDVVQRWBHVCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S/c1-3-9-6-5-7-10(8-9)14(11,12)13-4-2/h5-8H,3-4H2,1-2H3.
What are the key properties of ethyl 3-ethylbenzenesulfonate?
ethyl 3-ethylbenzenesulfonate has a molecular weight of 214.29 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethylbenzenesulfonate is sourced from PubChem (CID 22762316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).