About propyl 3-propylbenzenesulfonate
propyl 3-propylbenzenesulfonate (PubChem CID 139720072) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is propyl 3-propylbenzenesulfonate.
Molecular Properties
| Compound Name | propyl 3-propylbenzenesulfonate |
| PubChem CID | 139720072 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | propyl 3-propylbenzenesulfonate |
| SMILES | CCCOS(=O)(=O)c1cccc(CCC)c1 |
| InChI | InChI=1S/C12H18O3S/c1-3-6-11-7-5-8-12(10-11)16(13,14)15-9-4-2/h5,7-8,10H,3-4,6,9H2,1-2H3 |
| InChIKey | UNWVVBGCVTXCJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-propylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-propylbenzenesulfonate?
The IUPAC name of propyl 3-propylbenzenesulfonate (CID 139720072) is propyl 3-propylbenzenesulfonate.
What is the SMILES notation for propyl 3-propylbenzenesulfonate?
The canonical SMILES for propyl 3-propylbenzenesulfonate is CCCOS(=O)(=O)c1cccc(CCC)c1.
What is the InChIKey of propyl 3-propylbenzenesulfonate?
The InChIKey is UNWVVBGCVTXCJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-3-6-11-7-5-8-12(10-11)16(13,14)15-9-4-2/h5,7-8,10H,3-4,6,9H2,1-2H3.
What are the key properties of propyl 3-propylbenzenesulfonate?
propyl 3-propylbenzenesulfonate has a molecular weight of 242.34 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-propylbenzenesulfonate is sourced from PubChem (CID 139720072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).