C16H21NO3S — CID 11130613
(4-amino-2,2-dimethylbutyl) naphthalene-2-sulfonate (PubChem CID 11130613) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (4-amino-2,2-dimethylbutyl) naphthalene-2-sulfonate.
| Compound Name | (4-amino-2,2-dimethylbutyl) naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 11130613 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4-amino-2,2-dimethylbutyl) naphthalene-2-sulfonate |
| SMILES | CC(C)(CCN)COS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H21NO3S/c1-16(2,9-10-17)12-20-21(18,19)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11H,9-10,12,17H2,1-2H3 |
| InChIKey | DFYDBLRGADRSGT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|