C21H29NO5S — CID 10960517
[2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] naphthalene-2-sulfonate (PubChem CID 10960517) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is [2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] naphthalene-2-sulfonate.
| Compound Name | [2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 10960517 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] naphthalene-2-sulfonate |
| SMILES | CC(C)(CCNC(=O)OC(C)(C)C)COS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H29NO5S/c1-20(2,3)27-19(23)22-13-12-21(4,5)15-26-28(24,25)18-11-10-16-8-6-7-9-17(16)14-18/h6-11,14H,12-13,15H2,1-5H3,(H,22,23) |
| InChIKey | WNLXPUSQTJAGIG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|