C28H35N3O3 — CID 159108597
tert-butyl N-[(4R)-4-benzyl-4-(methylamino)-5-(naphthalen-2-ylamino)-5-oxopentyl]carbamate (PubChem CID 159108597) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-benzyl-4-(methylamino)-5-(naphthalen-2-ylamino)-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-benzyl-4-(methylamino)-5-(naphthalen-2-ylamino)-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 159108597 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl N-[(4R)-4-benzyl-4-(methylamino)-5-(naphthalen-2-ylamino)-5-oxopentyl]carbamate |
| SMILES | CN[C@](CCCNC(=O)OC(C)(C)C)(Cc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H35N3O3/c1-27(2,3)34-26(33)30-18-10-17-28(29-4,20-21-11-6-5-7-12-21)25(32)31-24-16-15-22-13-8-9-14-23(22)19-24/h5-9,11-16,19,29H,10,17-18,20H2,1-4H3,(H,30,33)(H,31,32)/t28-/m1/s1 |
| InChIKey | KEEWQOIBFBGGHG-MUUNZHRXSA-N |
| XLogP | 5.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|