C25H40N4O7 — CID 91037731
tert-butyl N-[(4S)-4-benzyl-4-carbamoyloxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentyl]carbamate (PubChem CID 91037731) has the molecular formula C25H40N4O7 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-benzyl-4-carbamoyloxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-benzyl-4-carbamoyloxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 91037731 |
| Molecular Formula | C25H40N4O7 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | tert-butyl N-[(4S)-4-benzyl-4-carbamoyloxy-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@](Cc1ccccc1)(OC(N)=O)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N4O7/c1-23(2,3)35-21(32)28-14-10-13-25(34-20(26)31,17-18-11-8-7-9-12-18)19(30)27-15-16-29-22(33)36-24(4,5)6/h7-9,11-12H,10,13-17H2,1-6H3,(H2,26,31)(H,27,30)(H,28,32)(H,29,33)/t25-/m0/s1 |
| InChIKey | LLWHYBFJLFUGSI-VWLOTQADSA-N |
| XLogP | 3.01 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|