C28H34N2O4 — CID 149436820
naphthalen-2-yl (2R)-2-benzyl-2-(methylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 149436820) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is naphthalen-2-yl (2R)-2-benzyl-2-(methylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | naphthalen-2-yl (2R)-2-benzyl-2-(methylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 149436820 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | naphthalen-2-yl (2R)-2-benzyl-2-(methylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CN[C@](CCCNC(=O)OC(C)(C)C)(Cc1ccccc1)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H34N2O4/c1-27(2,3)34-26(32)30-18-10-17-28(29-4,20-21-11-6-5-7-12-21)25(31)33-24-16-15-22-13-8-9-14-23(22)19-24/h5-9,11-16,19,29H,10,17-18,20H2,1-4H3,(H,30,32)/t28-/m1/s1 |
| InChIKey | MCGIFFXOJCCBMV-MUUNZHRXSA-N |
| XLogP | 5.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|