C27H28O6S — CID 22081751
tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-2-methyl-3-naphthalen-2-yl-3-oxopropanoate (PubChem CID 22081751) has the molecular formula C27H28O6S and a molecular weight of 480.58 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-2-methyl-3-naphthalen-2-yl-3-oxopropanoate.
| Compound Name | tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-2-methyl-3-naphthalen-2-yl-3-oxopropanoate |
|---|---|
| PubChem CID | 22081751 |
| Molecular Formula | C27H28O6S |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | tert-butyl 2-[(4-ethenylphenyl)sulfonyloxymethyl]-2-methyl-3-naphthalen-2-yl-3-oxopropanoate |
| SMILES | C=Cc1ccc(S(=O)(=O)OCC(C)(C(=O)OC(C)(C)C)C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C27H28O6S/c1-6-19-11-15-23(16-12-19)34(30,31)32-18-27(5,25(29)33-26(2,3)4)24(28)22-14-13-20-9-7-8-10-21(20)17-22/h6-17H,1,18H2,2-5H3 |
| InChIKey | GMBFIHNNLNHPMJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|