C23H26O3 — CID 22081647
2-phenylpropan-2-yl 2-(4-ethenylbenzoyl)-2-methylbutanoate (PubChem CID 22081647) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-(4-ethenylbenzoyl)-2-methylbutanoate.
| Compound Name | 2-phenylpropan-2-yl 2-(4-ethenylbenzoyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 22081647 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-phenylpropan-2-yl 2-(4-ethenylbenzoyl)-2-methylbutanoate |
| SMILES | C=Cc1ccc(C(=O)C(C)(CC)C(=O)OC(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26O3/c1-6-17-13-15-18(16-14-17)20(24)23(5,7-2)21(25)26-22(3,4)19-11-9-8-10-12-19/h6,8-16H,1,7H2,2-5H3 |
| InChIKey | FNPIVBCZXCYEGM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|