C22H23NO4S — CID 68507933
tert-butyl N-[[6-(benzenesulfonyl)naphthalen-1-yl]methyl]carbamate (PubChem CID 68507933) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is tert-butyl N-[[6-(benzenesulfonyl)naphthalen-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-(benzenesulfonyl)naphthalen-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68507933 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | tert-butyl N-[[6-(benzenesulfonyl)naphthalen-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc2cc(S(=O)(=O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C22H23NO4S/c1-22(2,3)27-21(24)23-15-17-9-7-8-16-14-19(12-13-20(16)17)28(25,26)18-10-5-4-6-11-18/h4-14H,15H2,1-3H3,(H,23,24) |
| InChIKey | YTLCULGNAVSHNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |