C12H16ClNO4S — CID 130114902
tert-butyl N-[(3-chlorosulfonylphenyl)methyl]carbamate (PubChem CID 130114902) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is tert-butyl N-[(3-chlorosulfonylphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-chlorosulfonylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 130114902 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | tert-butyl N-[(3-chlorosulfonylphenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H16ClNO4S/c1-12(2,3)18-11(15)14-8-9-5-4-6-10(7-9)19(13,16)17/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | ZHZTYLZUHTZGAM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |