C30H28N2O4S — CID 70053570
tert-butyl N-[[1-(benzenesulfonyl)-5-naphthalen-1-ylindol-3-yl]methyl]carbamate (PubChem CID 70053570) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is tert-butyl N-[[1-(benzenesulfonyl)-5-naphthalen-1-ylindol-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(benzenesulfonyl)-5-naphthalen-1-ylindol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 70053570 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | tert-butyl N-[[1-(benzenesulfonyl)-5-naphthalen-1-ylindol-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn(S(=O)(=O)c2ccccc2)c2ccc(-c3cccc4ccccc34)cc12 |
| InChI | InChI=1S/C30H28N2O4S/c1-30(2,3)36-29(33)31-19-23-20-32(37(34,35)24-12-5-4-6-13-24)28-17-16-22(18-27(23)28)26-15-9-11-21-10-7-8-14-25(21)26/h4-18,20H,19H2,1-3H3,(H,31,33) |
| InChIKey | QJBGVBRFYKIQFG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |