C19H20N2O6S2 — CID 163284603
tert-butyl N-[1-(benzenesulfonyl)indol-3-yl]sulfonylcarbamate (PubChem CID 163284603) has the molecular formula C19H20N2O6S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)indol-3-yl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)indol-3-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 163284603 |
| Molecular Formula | C19H20N2O6S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)indol-3-yl]sulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1cn(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H20N2O6S2/c1-19(2,3)27-18(22)20-28(23,24)17-13-21(16-12-8-7-11-15(16)17)29(25,26)14-9-5-4-6-10-14/h4-13H,1-3H3,(H,20,22) |
| InChIKey | SNLZWLHSXRDWEB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |