C18H29NO4S — CID 175359448
tert-butyl N-(benzenesulfonyl)carbamate;methylcyclohexane (PubChem CID 175359448) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is tert-butyl N-(benzenesulfonyl)carbamate;methylcyclohexane.
| Compound Name | tert-butyl N-(benzenesulfonyl)carbamate;methylcyclohexane |
|---|---|
| PubChem CID | 175359448 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl N-(benzenesulfonyl)carbamate;methylcyclohexane |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1ccccc1.CC1CCCCC1 |
| InChI | InChI=1S/C11H15NO4S.C7H14/c1-11(2,3)16-10(13)12-17(14,15)9-7-5-4-6-8-9;1-7-5-3-2-4-6-7/h4-8H,1-3H3,(H,12,13);7H,2-6H2,1H3 |
| InChIKey | PTJVVCBFNNTSFX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |