C25H41N3O4S — CID 163841745
tert-butyl N-[1-[4-(cyclononylsulfamoyl)phenyl]piperidin-4-yl]carbamate (PubChem CID 163841745) has the molecular formula C25H41N3O4S and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(cyclononylsulfamoyl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(cyclononylsulfamoyl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 163841745 |
| Molecular Formula | C25H41N3O4S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | tert-butyl N-[1-[4-(cyclononylsulfamoyl)phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc(S(=O)(=O)NC3CCCCCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H41N3O4S/c1-25(2,3)32-24(29)26-20-16-18-28(19-17-20)22-12-14-23(15-13-22)33(30,31)27-21-10-8-6-4-5-7-9-11-21/h12-15,20-21,27H,4-11,16-19H2,1-3H3,(H,26,29) |
| InChIKey | OMPMBWIEDCYUAL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |