C12H15NO5S — CID 146669883
tert-butyl N-(4-formylphenyl)sulfonylcarbamate (PubChem CID 146669883) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is tert-butyl N-(4-formylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-(4-formylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 146669883 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | tert-butyl N-(4-formylphenyl)sulfonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C12H15NO5S/c1-12(2,3)18-11(15)13-19(16,17)10-6-4-9(8-14)5-7-10/h4-8H,1-3H3,(H,13,15) |
| InChIKey | QGIKMLFMSKNESL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|