C22H26N2O8S2 — CID 101177082
[(Z)-4-methyl-4-[(4-methylphenyl)sulfonylcarbamoyloxy]pent-2-enyl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 101177082) has the molecular formula C22H26N2O8S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is [(Z)-4-methyl-4-[(4-methylphenyl)sulfonylcarbamoyloxy]pent-2-enyl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(Z)-4-methyl-4-[(4-methylphenyl)sulfonylcarbamoyloxy]pent-2-enyl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 101177082 |
| Molecular Formula | C22H26N2O8S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | [(Z)-4-methyl-4-[(4-methylphenyl)sulfonylcarbamoyloxy]pent-2-enyl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OC/C=C\C(C)(C)OC(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O8S2/c1-16-6-10-18(11-7-16)33(27,28)23-20(25)31-15-5-14-22(3,4)32-21(26)24-34(29,30)19-12-8-17(2)9-13-19/h5-14H,15H2,1-4H3,(H,23,25)(H,24,26)/b14-5- |
| InChIKey | RPYAZWROOXUXDL-RZNTYIFUSA-N |
| XLogP | 3.17 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|