C13H14FNO6S — CID 102021540
[(Z)-4-[(4-fluorophenyl)sulfonylcarbamoyloxy]but-2-enyl] acetate (PubChem CID 102021540) has the molecular formula C13H14FNO6S and a molecular weight of 331.32 g/mol. Its IUPAC name is [(Z)-4-[(4-fluorophenyl)sulfonylcarbamoyloxy]but-2-enyl] acetate.
| Compound Name | [(Z)-4-[(4-fluorophenyl)sulfonylcarbamoyloxy]but-2-enyl] acetate |
|---|---|
| PubChem CID | 102021540 |
| Molecular Formula | C13H14FNO6S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [(Z)-4-[(4-fluorophenyl)sulfonylcarbamoyloxy]but-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C\COC(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO6S/c1-10(16)20-8-2-3-9-21-13(17)15-22(18,19)12-6-4-11(14)5-7-12/h2-7H,8-9H2,1H3,(H,15,17)/b3-2- |
| InChIKey | ADVPLSPTDQEKJJ-IHWYPQMZSA-N |
| XLogP | 1.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|