C10H12FNO3S — CID 47268952
N-(4-fluorophenyl)sulfonyl-2-methylpropanamide (PubChem CID 47268952) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | N-(4-fluorophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 47268952 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | N-(4-fluorophenyl)sulfonyl-2-methylpropanamide |
| SMILES | CC(C)C(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FNO3S/c1-7(2)10(13)12-16(14,15)9-5-3-8(11)4-6-9/h3-7H,1-2H3,(H,12,13) |
| InChIKey | XSYCYSOZEKOSMJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |