C9H10FNO4S — CID 19693765
ethyl N-(4-fluorophenyl)sulfonylcarbamate (PubChem CID 19693765) has the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl N-(4-fluorophenyl)sulfonylcarbamate.
| Compound Name | ethyl N-(4-fluorophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 19693765 |
| Molecular Formula | C9H10FNO4S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | ethyl N-(4-fluorophenyl)sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H10FNO4S/c1-2-15-9(12)11-16(13,14)8-5-3-7(10)4-6-8/h3-6H,2H2,1H3,(H,11,12) |
| InChIKey | HZCDQFDIHGLSLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |